C12H15NS — CID 88885145
1-(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)ethanethione (PubChem CID 88885145) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 1-(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)ethanethione.
| Compound Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)ethanethione |
|---|---|
| PubChem CID | 88885145 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-3-yl)ethanethione |
| SMILES | CC(=S)C1Cc2ccccc2CN1C |
| InChI | InChI=1S/C12H15NS/c1-9(14)12-7-10-5-3-4-6-11(10)8-13(12)2/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | JSSWFLLLBALTAK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|