C15H23N — CID 21303286
2,3-di(propan-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 21303286) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2,3-di(propan-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 21303286 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2,3-di(propan-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CC(C)C1Cc2ccccc2CN1C(C)C |
| InChI | InChI=1S/C15H23N/c1-11(2)15-9-13-7-5-6-8-14(13)10-16(15)12(3)4/h5-8,11-12,15H,9-10H2,1-4H3 |
| InChIKey | ZWZRIMLAFPPXCN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |