C23H26N3O6P — CID 126733937
(2S)-4-amino-2-[[(2S)-2-ethylphosphanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-oxobutanoic acid (PubChem CID 126733937) has the molecular formula C23H26N3O6P and a molecular weight of 471.45 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S)-2-ethylphosphanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S)-2-ethylphosphanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126733937 |
| Molecular Formula | C23H26N3O6P |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2S)-4-amino-2-[[(2S)-2-ethylphosphanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-oxobutanoic acid |
| SMILES | CCP[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H26N3O6P/c1-2-33-21(20(28)25-18(22(29)30)11-19(24)27)26-23(31)32-12-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,17-18,21,33H,2,11-12H2,1H3,(H2,24,27)(H,25,28)(H,26,31)(H,29,30)/t18-,21-/m0/s1 |
| InChIKey | NLQOYNKHSAOUED-RXVVDRJESA-N |
| XLogP | 1.99 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|