C37H43N5O7 — CID 126734209
2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[benzyl-[[2-(propan-2-ylamino)-1,3-benzoxazole-5-carbonyl]amino]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 126734209) has the molecular formula C37H43N5O7 and a molecular weight of 669.78 g/mol. Its IUPAC name is 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[benzyl-[[2-(propan-2-ylamino)-1,3-benzoxazole-5-carbonyl]amino]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[benzyl-[[2-(propan-2-ylamino)-1,3-benzoxazole-5-carbonyl]amino]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 126734209 |
| Molecular Formula | C37H43N5O7 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | 2,4-dioxatricyclo[4.3.1.03,8]decan-10-yl N-[(2S,3R)-4-[benzyl-[[2-(propan-2-ylamino)-1,3-benzoxazole-5-carbonyl]amino]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)Nc1nc2cc(C(=O)NN(Cc3ccccc3)C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)OC3C4COC5OC3CC5C4)ccc2o1 |
| InChI | InChI=1S/C37H43N5O7/c1-22(2)38-36-39-29-17-25(13-14-31(29)48-36)34(44)41-42(19-24-11-7-4-8-12-24)20-30(43)28(15-23-9-5-3-6-10-23)40-37(45)49-33-27-16-26-18-32(33)47-35(26)46-21-27/h3-14,17,22,26-28,30,32-33,35,43H,15-16,18-21H2,1-2H3,(H,38,39)(H,40,45)(H,41,44)/t26?,27?,28-,30+,32?,33?,35?/m0/s1 |
| InChIKey | PKHYOOHFKQXUJR-QAPKKJBDSA-N |
| XLogP | 4.64 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|