About 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol
2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol (PubChem CID 126735836) has the molecular formula C16H33NS
and a molecular weight of 271.51 g/mol. Its IUPAC name is 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol.
Molecular Properties
| Compound Name | 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol |
| PubChem CID | 126735836 |
| Molecular Formula | C16H33NS |
| Molecular Weight | 271.51 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol |
| SMILES | C=C(NC(C)(C)CS)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H33NS/c1-12(17-16(8,9)11-18)13(15(5,6)7)10-14(2,3)4/h13,17-18H,1,10-11H2,2-9H3 |
| InChIKey | KUVVSGYBUZFGEZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol?
The IUPAC name of 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol (CID 126735836) is 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol.
What is the SMILES notation for 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol?
The canonical SMILES for 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol is C=C(NC(C)(C)CS)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol?
The InChIKey is KUVVSGYBUZFGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NS/c1-12(17-16(8,9)11-18)13(15(5,6)7)10-14(2,3)4/h13,17-18H,1,10-11H2,2-9H3.
What are the key properties of 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol?
2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol has a molecular weight of 271.51 g/mol, XLogP of 4.90, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)amino]-2-methylpropane-1-thiol is sourced from PubChem (CID 126735836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).