C18H37NS — CID 138480749
8-(butylamino)-2,2,4,5,5-pentamethylnon-8-ene-1-thiol (PubChem CID 138480749) has the molecular formula C18H37NS and a molecular weight of 299.57 g/mol. Its IUPAC name is 8-(butylamino)-2,2,4,5,5-pentamethylnon-8-ene-1-thiol.
| Compound Name | 8-(butylamino)-2,2,4,5,5-pentamethylnon-8-ene-1-thiol |
|---|---|
| PubChem CID | 138480749 |
| Molecular Formula | C18H37NS |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 8-(butylamino)-2,2,4,5,5-pentamethylnon-8-ene-1-thiol |
| SMILES | C=C(CCC(C)(C)C(C)CC(C)(C)CS)NCCCC |
| InChI | InChI=1S/C18H37NS/c1-8-9-12-19-16(3)10-11-18(6,7)15(2)13-17(4,5)14-20/h15,19-20H,3,8-14H2,1-2,4-7H3 |
| InChIKey | ALTZIYZKFPFZLH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|