C23H47N2PS — CID 134536294
[[5,7-dimethyl-7-(methylamino)-4-(2-methylbutan-2-yl)-5-phosphanyl-3-prop-1-en-2-yloct-1-en-2-yl]-propan-2-ylamino]methanethiol (PubChem CID 134536294) has the molecular formula C23H47N2PS and a molecular weight of 414.68 g/mol. Its IUPAC name is [[5,7-dimethyl-7-(methylamino)-4-(2-methylbutan-2-yl)-5-phosphanyl-3-prop-1-en-2-yloct-1-en-2-yl]-propan-2-ylamino]methanethiol.
| Compound Name | [[5,7-dimethyl-7-(methylamino)-4-(2-methylbutan-2-yl)-5-phosphanyl-3-prop-1-en-2-yloct-1-en-2-yl]-propan-2-ylamino]methanethiol |
|---|---|
| PubChem CID | 134536294 |
| Molecular Formula | C23H47N2PS |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | [[5,7-dimethyl-7-(methylamino)-4-(2-methylbutan-2-yl)-5-phosphanyl-3-prop-1-en-2-yloct-1-en-2-yl]-propan-2-ylamino]methanethiol |
| SMILES | C=C(C)C(C(=C)N(CS)C(C)C)C(C(C)(C)CC)C(C)(P)CC(C)(C)NC |
| InChI | InChI=1S/C23H47N2PS/c1-13-21(7,8)20(23(11,26)14-22(9,10)24-12)19(16(2)3)18(6)25(15-27)17(4)5/h17,19-20,24,27H,2,6,13-15,26H2,1,3-5,7-12H3 |
| InChIKey | OXWTVHNHWZTEJB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|