C16H33N — CID 166734429
N-hept-1-en-2-yl-2,3,3,4-tetramethylpentan-2-amine (PubChem CID 166734429) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N-hept-1-en-2-yl-2,3,3,4-tetramethylpentan-2-amine.
| Compound Name | N-hept-1-en-2-yl-2,3,3,4-tetramethylpentan-2-amine |
|---|---|
| PubChem CID | 166734429 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N-hept-1-en-2-yl-2,3,3,4-tetramethylpentan-2-amine |
| SMILES | C=C(CCCCC)NC(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C16H33N/c1-9-10-11-12-14(4)17-16(7,8)15(5,6)13(2)3/h13,17H,4,9-12H2,1-3,5-8H3 |
| InChIKey | NSVXILLZZXXWQG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|