C21H39N — CID 126613968
N,5-ditert-butyl-7-methyl-4-methylidene-3-propan-2-ylocta-1,7-dien-2-amine (PubChem CID 126613968) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is N,5-ditert-butyl-7-methyl-4-methylidene-3-propan-2-ylocta-1,7-dien-2-amine.
| Compound Name | N,5-ditert-butyl-7-methyl-4-methylidene-3-propan-2-ylocta-1,7-dien-2-amine |
|---|---|
| PubChem CID | 126613968 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | N,5-ditert-butyl-7-methyl-4-methylidene-3-propan-2-ylocta-1,7-dien-2-amine |
| SMILES | C=C(C)CC(C(=C)C(C(=C)NC(C)(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H39N/c1-14(2)13-18(20(7,8)9)16(5)19(15(3)4)17(6)22-21(10,11)12/h15,18-19,22H,1,5-6,13H2,2-4,7-12H3 |
| InChIKey | FEGFRUWIRYRNOE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|