About 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine
2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine (PubChem CID 89476334) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine.
Analyze 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine?
The IUPAC name of 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine (CID 89476334) is 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine.
What is the SMILES notation for 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine?
The canonical SMILES for 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine is C=C1NC(C)(C(C)(C)C)CC1(C)C.
What is the InChIKey of 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine?
The InChIKey is XXUIIFSHLIQJEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-9-11(5,6)8-12(7,13-9)10(2,3)4/h13H,1,8H2,2-7H3.
What are the key properties of 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine?
2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine has a molecular weight of 181.32 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,4,4-trimethyl-5-methylidenepyrrolidine is sourced from PubChem (CID 89476334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).