C29H29O3P — CID 126736428
2-diphenylphosphoryl-4-[[4-(2-methylpropyl)phenyl]methoxy]phenol (PubChem CID 126736428) has the molecular formula C29H29O3P and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-diphenylphosphoryl-4-[[4-(2-methylpropyl)phenyl]methoxy]phenol.
| Compound Name | 2-diphenylphosphoryl-4-[[4-(2-methylpropyl)phenyl]methoxy]phenol |
|---|---|
| PubChem CID | 126736428 |
| Molecular Formula | C29H29O3P |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-diphenylphosphoryl-4-[[4-(2-methylpropyl)phenyl]methoxy]phenol |
| SMILES | CC(C)Cc1ccc(COc2ccc(O)c(P(=O)(c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H29O3P/c1-22(2)19-23-13-15-24(16-14-23)21-32-25-17-18-28(30)29(20-25)33(31,26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-18,20,22,30H,19,21H2,1-2H3 |
| InChIKey | HKOGNIMNUYAJLQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|