C44H41O4P — CID 126737195
2-diphenylphosphoryl-4-[(4-ethenylphenyl)methoxy]-1-[[4-[4-(2-methylpropyl)phenoxy]phenyl]methoxy]benzene (PubChem CID 126737195) has the molecular formula C44H41O4P and a molecular weight of 664.78 g/mol. Its IUPAC name is 2-diphenylphosphoryl-4-[(4-ethenylphenyl)methoxy]-1-[[4-[4-(2-methylpropyl)phenoxy]phenyl]methoxy]benzene.
| Compound Name | 2-diphenylphosphoryl-4-[(4-ethenylphenyl)methoxy]-1-[[4-[4-(2-methylpropyl)phenoxy]phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 126737195 |
| Molecular Formula | C44H41O4P |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 2-diphenylphosphoryl-4-[(4-ethenylphenyl)methoxy]-1-[[4-[4-(2-methylpropyl)phenoxy]phenyl]methoxy]benzene |
| SMILES | C=Cc1ccc(COc2ccc(OCc3ccc(Oc4ccc(CC(C)C)cc4)cc3)c(P(=O)(c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C44H41O4P/c1-4-34-15-17-36(18-16-34)31-46-40-27-28-43(44(30-40)49(45,41-11-7-5-8-12-41)42-13-9-6-10-14-42)47-32-37-21-25-39(26-22-37)48-38-23-19-35(20-24-38)29-33(2)3/h4-28,30,33H,1,29,31-32H2,2-3H3 |
| InChIKey | XQAFRLYUEWZMCU-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|