C24H34NO4P — CID 132582179
N-[diethoxyphosphoryl-[4-[(4-ethenylphenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 132582179) has the molecular formula C24H34NO4P and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-[4-[(4-ethenylphenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[diethoxyphosphoryl-[4-[(4-ethenylphenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 132582179 |
| Molecular Formula | C24H34NO4P |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[diethoxyphosphoryl-[4-[(4-ethenylphenyl)methoxy]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | C=Cc1ccc(COc2ccc(C(NCC(C)C)P(=O)(OCC)OCC)cc2)cc1 |
| InChI | InChI=1S/C24H34NO4P/c1-6-20-9-11-21(12-10-20)18-27-23-15-13-22(14-16-23)24(25-17-19(4)5)30(26,28-7-2)29-8-3/h6,9-16,19,24-25H,1,7-8,17-18H2,2-5H3 |
| InChIKey | UKVDKQWNTFSLGU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|