C22H25NO3 — CID 11100242
methyl (2S)-2-[[4-[(4-ethenylphenyl)methoxy]phenyl]methylideneamino]-3-methylbutanoate (PubChem CID 11100242) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(4-ethenylphenyl)methoxy]phenyl]methylideneamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[4-[(4-ethenylphenyl)methoxy]phenyl]methylideneamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11100242 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl (2S)-2-[[4-[(4-ethenylphenyl)methoxy]phenyl]methylideneamino]-3-methylbutanoate |
| SMILES | C=Cc1ccc(COc2ccc(/C=N/[C@H](C(=O)OC)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-5-17-6-8-19(9-7-17)15-26-20-12-10-18(11-13-20)14-23-21(16(2)3)22(24)25-4/h5-14,16,21H,1,15H2,2-4H3/b23-14+/t21-/m0/s1 |
| InChIKey | RYRDDYYFPWVXLH-VSIOZEBNSA-N |
| XLogP | 4.53 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|