C28H31N3O5 — CID 3459143
N-(4-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylpropanediamide (PubChem CID 3459143) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylpropanediamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 3459143 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylpropanediamide |
| SMILES | COc1ccc(COc2ccc(C=NNC(=O)C(C(=O)Nc3ccc(OC)cc3)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O5/c1-19(2)26(27(32)30-22-9-15-24(35-4)16-10-22)28(33)31-29-17-20-5-13-25(14-6-20)36-18-21-7-11-23(34-3)12-8-21/h5-17,19,26H,18H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | NFIIXIHKWDVFMC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|