C29H32BrN3O5 — CID 5032597
N-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide (PubChem CID 5032597) has the molecular formula C29H32BrN3O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide.
| Compound Name | N-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 5032597 |
| Molecular Formula | C29H32BrN3O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-propan-2-ylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C(=O)NN=Cc2cc(Br)c(OCc3ccc(C)cc3)c(OC)c2)C(C)C)cc1 |
| InChI | InChI=1S/C29H32BrN3O5/c1-18(2)26(28(34)32-22-10-12-23(36-4)13-11-22)29(35)33-31-16-21-14-24(30)27(25(15-21)37-5)38-17-20-8-6-19(3)7-9-20/h6-16,18,26H,17H2,1-5H3,(H,32,34)(H,33,35) |
| InChIKey | OYBMUMRAWVGTRB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|