C25H24FN3O4 — CID 3999202
N-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide (PubChem CID 3999202) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide.
| Compound Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 3999202 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)C(=O)NN=Cc2ccc(OCc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H24FN3O4/c1-17(24(30)28-21-9-13-22(32-2)14-10-21)25(31)29-27-15-18-5-11-23(12-6-18)33-16-19-3-7-20(26)8-4-19/h3-15,17H,16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | ZRULXIYBRHVTMD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|