C17H19FN2O4 — CID 126736818
tert-butyl 4-(5-fluoro-2-methyl-4-nitrophenyl)-2,3-dihydropyridine-6-carboxylate (PubChem CID 126736818) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-2-methyl-4-nitrophenyl)-2,3-dihydropyridine-6-carboxylate.
| Compound Name | tert-butyl 4-(5-fluoro-2-methyl-4-nitrophenyl)-2,3-dihydropyridine-6-carboxylate |
|---|---|
| PubChem CID | 126736818 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | tert-butyl 4-(5-fluoro-2-methyl-4-nitrophenyl)-2,3-dihydropyridine-6-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])c(F)cc1C1=CC(C(=O)OC(C)(C)C)=NCC1 |
| InChI | InChI=1S/C17H19FN2O4/c1-10-7-15(20(22)23)13(18)9-12(10)11-5-6-19-14(8-11)16(21)24-17(2,3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | WERZEOWVHALLGM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|