C8H17FN2O2S — CID 126737674
4-fluoro-1-propan-2-ylpiperidine-4-sulfonamide (PubChem CID 126737674) has the molecular formula C8H17FN2O2S and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-fluoro-1-propan-2-ylpiperidine-4-sulfonamide.
| Compound Name | 4-fluoro-1-propan-2-ylpiperidine-4-sulfonamide |
|---|---|
| PubChem CID | 126737674 |
| Molecular Formula | C8H17FN2O2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-fluoro-1-propan-2-ylpiperidine-4-sulfonamide |
| SMILES | CC(C)N1CCC(F)(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H17FN2O2S/c1-7(2)11-5-3-8(9,4-6-11)14(10,12)13/h7H,3-6H2,1-2H3,(H2,10,12,13) |
| InChIKey | INAZZMQZBICIPI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |