C12H22F2N2 — CID 146477426
(4S)-3,3-difluoro-8-propan-2-yl-8-azaspiro[4.5]decan-4-amine (PubChem CID 146477426) has the molecular formula C12H22F2N2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4S)-3,3-difluoro-8-propan-2-yl-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4S)-3,3-difluoro-8-propan-2-yl-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 146477426 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (4S)-3,3-difluoro-8-propan-2-yl-8-azaspiro[4.5]decan-4-amine |
| SMILES | CC(C)N1CCC2(CC1)CCC(F)(F)[C@H]2N |
| InChI | InChI=1S/C12H22F2N2/c1-9(2)16-7-5-11(6-8-16)3-4-12(13,14)10(11)15/h9-10H,3-8,15H2,1-2H3/t10-/m0/s1 |
| InChIKey | UNWNCZGBQSTINM-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |