About (8R)-7,7-difluorospiro[2.5]octan-8-amine
(8R)-7,7-difluorospiro[2.5]octan-8-amine (PubChem CID 162559331) has the molecular formula C8H13F2N
and a molecular weight of 161.19 g/mol. Its IUPAC name is (8R)-7,7-difluorospiro[2.5]octan-8-amine.
Molecular Properties
| Compound Name | (8R)-7,7-difluorospiro[2.5]octan-8-amine |
| PubChem CID | 162559331 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (8R)-7,7-difluorospiro[2.5]octan-8-amine |
| SMILES | N[C@H]1C(F)(F)CCCC12CC2 |
| InChI | InChI=1S/C8H13F2N/c9-8(10)3-1-2-7(4-5-7)6(8)11/h6H,1-5,11H2/t6-/m1/s1 |
| InChIKey | RUFRYBGMDVORMP-ZCFIWIBFSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8R)-7,7-difluorospiro[2.5]octan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-7,7-difluorospiro[2.5]octan-8-amine?
The IUPAC name of (8R)-7,7-difluorospiro[2.5]octan-8-amine (CID 162559331) is (8R)-7,7-difluorospiro[2.5]octan-8-amine.
What is the SMILES notation for (8R)-7,7-difluorospiro[2.5]octan-8-amine?
The canonical SMILES for (8R)-7,7-difluorospiro[2.5]octan-8-amine is N[C@H]1C(F)(F)CCCC12CC2.
What is the InChIKey of (8R)-7,7-difluorospiro[2.5]octan-8-amine?
The InChIKey is RUFRYBGMDVORMP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H13F2N/c9-8(10)3-1-2-7(4-5-7)6(8)11/h6H,1-5,11H2/t6-/m1/s1.
What are the key properties of (8R)-7,7-difluorospiro[2.5]octan-8-amine?
(8R)-7,7-difluorospiro[2.5]octan-8-amine has a molecular weight of 161.19 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-7,7-difluorospiro[2.5]octan-8-amine is sourced from PubChem (CID 162559331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).