C12H19N — CID 162769943
8-propan-2-yl-8-azaspiro[4.5]deca-1,3-diene (PubChem CID 162769943) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 8-propan-2-yl-8-azaspiro[4.5]deca-1,3-diene.
| Compound Name | 8-propan-2-yl-8-azaspiro[4.5]deca-1,3-diene |
|---|---|
| PubChem CID | 162769943 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 8-propan-2-yl-8-azaspiro[4.5]deca-1,3-diene |
| SMILES | CC(C)N1CCC2(C=CC=C2)CC1 |
| InChI | InChI=1S/C12H19N/c1-11(2)13-9-7-12(8-10-13)5-3-4-6-12/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | YTHBIPSCINAOSX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |