C20H34F2O — CID 126738420
(1R)-1-[3-(4-ethenylcyclohexyl)pentyl]-2,3-difluoro-4-methoxycyclohexane (PubChem CID 126738420) has the molecular formula C20H34F2O and a molecular weight of 328.49 g/mol. Its IUPAC name is (1R)-1-[3-(4-ethenylcyclohexyl)pentyl]-2,3-difluoro-4-methoxycyclohexane.
| Compound Name | (1R)-1-[3-(4-ethenylcyclohexyl)pentyl]-2,3-difluoro-4-methoxycyclohexane |
|---|---|
| PubChem CID | 126738420 |
| Molecular Formula | C20H34F2O |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | (1R)-1-[3-(4-ethenylcyclohexyl)pentyl]-2,3-difluoro-4-methoxycyclohexane |
| SMILES | C=CC1CCC(C(CC)CC[C@@H]2CCC(OC)C(F)C2F)CC1 |
| InChI | InChI=1S/C20H34F2O/c1-4-14-6-8-16(9-7-14)15(5-2)10-11-17-12-13-18(23-3)20(22)19(17)21/h4,14-20H,1,5-13H2,2-3H3/t14?,15?,16?,17-,18?,19?,20?/m1/s1 |
| InChIKey | ZZXMAZQNAXVHML-SBXUMLPXSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|