C17H12F3N3O3 — CID 126739007
methyl 3-[[3-(difluoromethoxy)-2-pyridinyl]amino]-5-fluoroquinoline-8-carboxylate (PubChem CID 126739007) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is methyl 3-[[3-(difluoromethoxy)-2-pyridinyl]amino]-5-fluoroquinoline-8-carboxylate.
| Compound Name | methyl 3-[[3-(difluoromethoxy)-2-pyridinyl]amino]-5-fluoroquinoline-8-carboxylate |
|---|---|
| PubChem CID | 126739007 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | methyl 3-[[3-(difluoromethoxy)-2-pyridinyl]amino]-5-fluoroquinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc(F)c2cc(Nc3ncccc3OC(F)F)cnc12 |
| InChI | InChI=1S/C17H12F3N3O3/c1-25-16(24)10-4-5-12(18)11-7-9(8-22-14(10)11)23-15-13(26-17(19)20)3-2-6-21-15/h2-8,17H,1H3,(H,21,23) |
| InChIKey | HTKLJWFPKOTSSC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |