C15H12F2N2O4 — CID 56824300
methyl 4-[[3-(difluoromethoxy)-2-pyridinyl]carbamoyl]benzoate (PubChem CID 56824300) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is methyl 4-[[3-(difluoromethoxy)-2-pyridinyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(difluoromethoxy)-2-pyridinyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 56824300 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | methyl 4-[[3-(difluoromethoxy)-2-pyridinyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ncccc2OC(F)F)cc1 |
| InChI | InChI=1S/C15H12F2N2O4/c1-22-14(21)10-6-4-9(5-7-10)13(20)19-12-11(23-15(16)17)3-2-8-18-12/h2-8,15H,1H3,(H,18,19,20) |
| InChIKey | XGKLGFJNFNREHH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |