C9H17N — CID 12673955
4,6-dimethylheptanenitrile (PubChem CID 12673955) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 4,6-dimethylheptanenitrile.
| Compound Name | 4,6-dimethylheptanenitrile |
|---|---|
| PubChem CID | 12673955 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 4,6-dimethylheptanenitrile |
| SMILES | CC(C)CC(C)CCC#N |
| InChI | InChI=1S/C9H17N/c1-8(2)7-9(3)5-4-6-10/h8-9H,4-5,7H2,1-3H3 |
| InChIKey | VHTOQNYEKFLXML-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |