C10H19N — CID 142940400
4,6-dimethyloctanenitrile (PubChem CID 142940400) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 4,6-dimethyloctanenitrile.
| Compound Name | 4,6-dimethyloctanenitrile |
|---|---|
| PubChem CID | 142940400 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 4,6-dimethyloctanenitrile |
| SMILES | CCC(C)CC(C)CCC#N |
| InChI | InChI=1S/C10H19N/c1-4-9(2)8-10(3)6-5-7-11/h9-10H,4-6,8H2,1-3H3 |
| InChIKey | BYFJJKOEFOJLCC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |