C18H18ClN5O2S — CID 12674311
9-chloro-N,N-dimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine (PubChem CID 12674311) has the molecular formula C18H18ClN5O2S and a molecular weight of 403.90 g/mol. Its IUPAC name is 9-chloro-N,N-dimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine.
| Compound Name | 9-chloro-N,N-dimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine |
|---|---|
| PubChem CID | 12674311 |
| Molecular Formula | C18H18ClN5O2S |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 9-chloro-N,N-dimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine |
| SMILES | CN(C)C12c3cc(Cl)ccc3SCCC1N=NN2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18ClN5O2S/c1-22(2)18-15-11-12(19)3-8-16(15)27-10-9-17(18)20-21-23(18)13-4-6-14(7-5-13)24(25)26/h3-8,11,17H,9-10H2,1-2H3 |
| InChIKey | WIZJTZGQHKIQGN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|