C20H20ClN5O2S — CID 12674315
9-chloro-1-(4-nitrophenyl)-10b-pyrrolidin-1-yl-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazole (PubChem CID 12674315) has the molecular formula C20H20ClN5O2S and a molecular weight of 429.93 g/mol. Its IUPAC name is 9-chloro-1-(4-nitrophenyl)-10b-pyrrolidin-1-yl-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazole.
| Compound Name | 9-chloro-1-(4-nitrophenyl)-10b-pyrrolidin-1-yl-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazole |
|---|---|
| PubChem CID | 12674315 |
| Molecular Formula | C20H20ClN5O2S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 9-chloro-1-(4-nitrophenyl)-10b-pyrrolidin-1-yl-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazole |
| SMILES | O=[N+]([O-])c1ccc(N2N=NC3CCSc4ccc(Cl)cc4C32N2CCCC2)cc1 |
| InChI | InChI=1S/C20H20ClN5O2S/c21-14-3-8-18-17(13-14)20(24-10-1-2-11-24)19(9-12-29-18)22-23-25(20)15-4-6-16(7-5-15)26(27)28/h3-8,13,19H,1-2,9-12H2 |
| InChIKey | WUVMATKRZYXSSY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|