C19H21N5O2S — CID 12674310
N,N,9-trimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine (PubChem CID 12674310) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N,N,9-trimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine.
| Compound Name | N,N,9-trimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine |
|---|---|
| PubChem CID | 12674310 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N,N,9-trimethyl-1-(4-nitrophenyl)-4,5-dihydro-3aH-[1]benzothiepino[4,5-d]triazol-10b-amine |
| SMILES | Cc1ccc2c(c1)C1(N(C)C)C(CCS2)N=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-13-4-9-17-16(12-13)19(22(2)3)18(10-11-27-17)20-21-23(19)14-5-7-15(8-6-14)24(25)26/h4-9,12,18H,10-11H2,1-3H3 |
| InChIKey | RLFJHUCHLNMYPR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|