C23H25N5O3 — CID 7858728
4-[(3aS,4E,7aR)-4-benzylidene-3-(4-nitrophenyl)-5,6,7,7a-tetrahydrobenzotriazol-3a-yl]morpholine (PubChem CID 7858728) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[(3aS,4E,7aR)-4-benzylidene-3-(4-nitrophenyl)-5,6,7,7a-tetrahydrobenzotriazol-3a-yl]morpholine.
| Compound Name | 4-[(3aS,4E,7aR)-4-benzylidene-3-(4-nitrophenyl)-5,6,7,7a-tetrahydrobenzotriazol-3a-yl]morpholine |
|---|---|
| PubChem CID | 7858728 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-[(3aS,4E,7aR)-4-benzylidene-3-(4-nitrophenyl)-5,6,7,7a-tetrahydrobenzotriazol-3a-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2N=N[C@@H]3CCC/C(=C\c4ccccc4)[C@@]32N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25N5O3/c29-28(30)21-11-9-20(10-12-21)27-23(26-13-15-31-16-14-26)19(7-4-8-22(23)24-25-27)17-18-5-2-1-3-6-18/h1-3,5-6,9-12,17,22H,4,7-8,13-16H2/b19-17+/t22-,23+/m1/s1 |
| InChIKey | PJYHCFFTAYWCEB-WKQLCDHFSA-N |
| XLogP | 4.45 |
| TPSA | 83.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|