C24H25ClN6O3 — CID 28559507
4-[(6aR,10aR)-13-chloro-6-(4-nitrophenyl)-8,9,10,10a-tetrahydro-7H-phthalazino[1,2-c][1,2,4]benzotriazin-6a-yl]morpholine (PubChem CID 28559507) has the molecular formula C24H25ClN6O3 and a molecular weight of 480.96 g/mol. Its IUPAC name is 4-[(6aR,10aR)-13-chloro-6-(4-nitrophenyl)-8,9,10,10a-tetrahydro-7H-phthalazino[1,2-c][1,2,4]benzotriazin-6a-yl]morpholine.
| Compound Name | 4-[(6aR,10aR)-13-chloro-6-(4-nitrophenyl)-8,9,10,10a-tetrahydro-7H-phthalazino[1,2-c][1,2,4]benzotriazin-6a-yl]morpholine |
|---|---|
| PubChem CID | 28559507 |
| Molecular Formula | C24H25ClN6O3 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-[(6aR,10aR)-13-chloro-6-(4-nitrophenyl)-8,9,10,10a-tetrahydro-7H-phthalazino[1,2-c][1,2,4]benzotriazin-6a-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2N=C3c4ccccc4C(Cl)=NN3[C@@H]3CCCC[C@]32N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H25ClN6O3/c25-22-19-5-1-2-6-20(19)23-27-30(17-8-10-18(11-9-17)31(32)33)24(28-13-15-34-16-14-28)12-4-3-7-21(24)29(23)26-22/h1-2,5-6,8-11,21H,3-4,7,12-16H2/t21-,24-/m1/s1 |
| InChIKey | CTTQAZGSWYRPNV-ZJSXRUAMSA-N |
| XLogP | 3.96 |
| TPSA | 86.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|