C17H23ClN4OS — CID 13346866
4-[1-(4-chlorophenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d]triazol-9a-yl]morpholine (PubChem CID 13346866) has the molecular formula C17H23ClN4OS and a molecular weight of 366.92 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d]triazol-9a-yl]morpholine.
| Compound Name | 4-[1-(4-chlorophenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d]triazol-9a-yl]morpholine |
|---|---|
| PubChem CID | 13346866 |
| Molecular Formula | C17H23ClN4OS |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d]triazol-9a-yl]morpholine |
| SMILES | Clc1ccc(N2N=NC3CCSCCCC32N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H23ClN4OS/c18-14-2-4-15(5-3-14)22-17(21-8-10-23-11-9-21)7-1-12-24-13-6-16(17)19-20-22/h2-5,16H,1,6-13H2 |
| InChIKey | GFVCHGKBJDSJDO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |