C20H23N5O3 — CID 98082858
4-[(1R,2R,6S,7R,8S,12S)-3-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.5.1.02,6.08,12]trideca-4,10-dien-2-yl]morpholine (PubChem CID 98082858) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7R,8S,12S)-3-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.5.1.02,6.08,12]trideca-4,10-dien-2-yl]morpholine.
| Compound Name | 4-[(1R,2R,6S,7R,8S,12S)-3-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.5.1.02,6.08,12]trideca-4,10-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 98082858 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[(1R,2R,6S,7R,8S,12S)-3-(4-nitrophenyl)-3,4,5-triazatetracyclo[5.5.1.02,6.08,12]trideca-4,10-dien-2-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2N=N[C@H]3[C@@H]4C[C@H]([C@H]5C=CC[C@@H]54)[C@]32N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c26-25(27)14-6-4-13(5-7-14)24-20(23-8-10-28-11-9-23)18-12-17(19(20)21-22-24)15-2-1-3-16(15)18/h1,3-7,15-19H,2,8-12H2/t15-,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | YXPBMFDBEUUTDY-YDETXVTLSA-N |
| XLogP | 3.02 |
| TPSA | 83.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|