C30H40N10O10P2 — CID 5064491
4-[[6-dimorpholin-4-ylphosphoryl-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-morpholin-4-ylphosphoryl]morpholine (PubChem CID 5064491) has the molecular formula C30H40N10O10P2 and a molecular weight of 762.66 g/mol. Its IUPAC name is 4-[[6-dimorpholin-4-ylphosphoryl-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-morpholin-4-ylphosphoryl]morpholine.
| Compound Name | 4-[[6-dimorpholin-4-ylphosphoryl-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-morpholin-4-ylphosphoryl]morpholine |
|---|---|
| PubChem CID | 5064491 |
| Molecular Formula | C30H40N10O10P2 |
| Molecular Weight | 762.66 g/mol |
| Exact Mass | 762.24 |
| IUPAC Name | 4-[[6-dimorpholin-4-ylphosphoryl-1,4-bis(4-nitrophenyl)-1,2,4,5-tetrazin-3-yl]-morpholin-4-ylphosphoryl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(P(=O)(N3CCOCC3)N3CCOCC3)N(c3ccc([N+](=O)[O-])cc3)N=C2P(=O)(N2CCOCC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H40N10O10P2/c41-39(42)27-5-1-25(2-6-27)37-29(51(45,33-9-17-47-18-10-33)34-11-19-48-20-12-34)32-38(26-3-7-28(8-4-26)40(43)44)30(31-37)52(46,35-13-21-49-22-14-35)36-15-23-50-24-16-36/h1-8H,9-24H2 |
| InChIKey | QEXPNMJTGRQZJD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 201.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|