C9H10N2O5S — CID 23086776
4-(4-nitrophenyl)-1,3,4-oxathiazinane 3,3-dioxide (PubChem CID 23086776) has the molecular formula C9H10N2O5S and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,3,4-oxathiazinane 3,3-dioxide.
| Compound Name | 4-(4-nitrophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
|---|---|
| PubChem CID | 23086776 |
| Molecular Formula | C9H10N2O5S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(4-nitrophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
| SMILES | O=[N+]([O-])c1ccc(N2CCOCS2(=O)=O)cc1 |
| InChI | InChI=1S/C9H10N2O5S/c12-11(13)9-3-1-8(2-4-9)10-5-6-16-7-17(10,14)15/h1-4H,5-7H2 |
| InChIKey | PQKCNWHPJQDZJA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|