C18H24FN3O4 — CID 126744668
[4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 126744668) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is [4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 126744668 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Cc1c(CN2CCN(C(=O)C3CCCO3)C(C)C2)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24FN3O4/c1-12-10-20(5-6-21(12)18(23)17-4-3-7-26-17)11-14-8-15(19)9-16(13(14)2)22(24)25/h8-9,12,17H,3-7,10-11H2,1-2H3 |
| InChIKey | SFPPZFDDVBNWQL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|