C19H26ClN3O4 — CID 126744704
[4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxan-4-yl)methanone (PubChem CID 126744704) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is [4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 126744704 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-(oxan-4-yl)methanone |
| SMILES | Cc1c(CN2CCN(C(=O)C3CCOCC3)C(C)C2)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26ClN3O4/c1-13-11-21(5-6-22(13)19(24)15-3-7-27-8-4-15)12-16-9-17(20)10-18(14(16)2)23(25)26/h9-10,13,15H,3-8,11-12H2,1-2H3 |
| InChIKey | FJQHVFWGPLIBBL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|