C20H26N4O3 — CID 118541372
3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile (PubChem CID 118541372) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile.
| Compound Name | 3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 118541372 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile |
| SMILES | Cc1c(CN2CCN(C(=O)C3CCCC3)[C@@H](C)C2)cc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O3/c1-14-12-22(7-8-23(14)20(25)17-5-3-4-6-17)13-18-9-16(11-21)10-19(15(18)2)24(26)27/h9-10,14,17H,3-8,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | XSESIOQBUSCVEA-AWEZNQCLSA-N |
| XLogP | 3.00 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|