C18H13F4N5O — CID 126745279
4-N-(2-fluorophenyl)-5-methanimidoyl-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine (PubChem CID 126745279) has the molecular formula C18H13F4N5O and a molecular weight of 391.33 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)-5-methanimidoyl-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-fluorophenyl)-5-methanimidoyl-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 126745279 |
| Molecular Formula | C18H13F4N5O |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-N-(2-fluorophenyl)-5-methanimidoyl-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C/c1c(Nc2ccc(OC(F)(F)F)cc2)ncnc1Nc1ccccc1F |
| InChI | InChI=1S/C18H13F4N5O/c19-14-3-1-2-4-15(14)27-17-13(9-23)16(24-10-25-17)26-11-5-7-12(8-6-11)28-18(20,21)22/h1-10,23H,(H2,24,25,26,27)/b23-9+ |
| InChIKey | XMBKQKMBUNCBRJ-NUGSKGIGSA-N |
| XLogP | 5.00 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|