C7H11N3 — CID 126746270
5-(2,5-dihydro-1H-pyrrol-2-yl)-4,5-dihydro-1H-imidazole (PubChem CID 126746270) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 5-(2,5-dihydro-1H-pyrrol-2-yl)-4,5-dihydro-1H-imidazole.
| Compound Name | 5-(2,5-dihydro-1H-pyrrol-2-yl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 126746270 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 5-(2,5-dihydro-1H-pyrrol-2-yl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=CC(C2CN=CN2)NC1 |
| InChI | InChI=1S/C7H11N3/c1-2-6(9-3-1)7-4-8-5-10-7/h1-2,5-7,9H,3-4H2,(H,8,10) |
| InChIKey | SYKIVMKFLUAUIG-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|