C8H13N3 — CID 141029351
N-cyclopent-2-en-1-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 141029351) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N-cyclopent-2-en-1-yl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-cyclopent-2-en-1-yl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 141029351 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-cyclopent-2-en-1-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C1=CC(NC2=NCCN2)CC1 |
| InChI | InChI=1S/C8H13N3/c1-2-4-7(3-1)11-8-9-5-6-10-8/h1,3,7H,2,4-6H2,(H2,9,10,11) |
| InChIKey | FHIKYBRCQOXKOO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|