C12H11N3 — CID 126746624
2-methyl-1,2-dihydropyrido[3,2-h]quinazoline (PubChem CID 126746624) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-methyl-1,2-dihydropyrido[3,2-h]quinazoline.
| Compound Name | 2-methyl-1,2-dihydropyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 126746624 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-methyl-1,2-dihydropyrido[3,2-h]quinazoline |
| SMILES | CC1N=Cc2ccc3cccnc3c2N1 |
| InChI | InChI=1S/C12H11N3/c1-8-14-7-10-5-4-9-3-2-6-13-11(9)12(10)15-8/h2-8,15H,1H3 |
| InChIKey | JSWRGWVTYFRYMI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |