C12H11N3O — CID 114988001
3-(methylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one (PubChem CID 114988001) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-(methylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one.
| Compound Name | 3-(methylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one |
|---|---|
| PubChem CID | 114988001 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-(methylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one |
| SMILES | CNC1C(=O)Nc2c1ccc1cccnc21 |
| InChI | InChI=1S/C12H11N3O/c1-13-11-8-5-4-7-3-2-6-14-9(7)10(8)15-12(11)16/h2-6,11,13H,1H3,(H,15,16) |
| InChIKey | DVCRILMLTLHHAS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |