C13H13N3O — CID 114988376
3-(ethylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one (PubChem CID 114988376) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-(ethylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one.
| Compound Name | 3-(ethylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one |
|---|---|
| PubChem CID | 114988376 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(ethylamino)-1,3-dihydropyrrolo[3,2-h]quinolin-2-one |
| SMILES | CCNC1C(=O)Nc2c1ccc1cccnc21 |
| InChI | InChI=1S/C13H13N3O/c1-2-14-12-9-6-5-8-4-3-7-15-10(8)11(9)16-13(12)17/h3-7,12,14H,2H2,1H3,(H,16,17) |
| InChIKey | VEZKQWZYLJFTSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |