C4H5FN2 — CID 126747074
(E)-2-fluoro-N'-methylideneprop-2-ene-1,3-diimine (PubChem CID 126747074) has the molecular formula C4H5FN2 and a molecular weight of 100.10 g/mol. Its IUPAC name is (E)-2-fluoro-N'-methylideneprop-2-ene-1,3-diimine.
| Compound Name | (E)-2-fluoro-N'-methylideneprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 126747074 |
| Molecular Formula | C4H5FN2 |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | (E)-2-fluoro-N'-methylideneprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C(F)=C\N=C |
| InChI | InChI=1S/C4H5FN2/c1-7-3-4(5)2-6/h2-3,6H,1H2/b4-3+,6-2+ |
| InChIKey | YLENJPRQCTVYQZ-RPCHPSCSSA-N |
| XLogP | 1.15 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|