C5H7FN2 — CID 123586364
N'-ethylidene-2-fluoroprop-2-ene-1,3-diimine (PubChem CID 123586364) has the molecular formula C5H7FN2 and a molecular weight of 114.12 g/mol. Its IUPAC name is N'-ethylidene-2-fluoroprop-2-ene-1,3-diimine.
| Compound Name | N'-ethylidene-2-fluoroprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 123586364 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | N'-ethylidene-2-fluoroprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C(F)=C/N=C/C |
| InChI | InChI=1S/C5H7FN2/c1-2-8-4-5(6)3-7/h2-4,7H,1H3/b5-4?,7-3+,8-2+ |
| InChIKey | VLVJVOFBGPQJMK-BQDBOPBISA-N |
| XLogP | 1.54 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|