C6H7F3N2 — CID 167260520
(E)-N'-ethylidene-2-(trifluoromethyl)prop-2-ene-1,3-diimine (PubChem CID 167260520) has the molecular formula C6H7F3N2 and a molecular weight of 164.13 g/mol. Its IUPAC name is (E)-N'-ethylidene-2-(trifluoromethyl)prop-2-ene-1,3-diimine.
| Compound Name | (E)-N'-ethylidene-2-(trifluoromethyl)prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 167260520 |
| Molecular Formula | C6H7F3N2 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (E)-N'-ethylidene-2-(trifluoromethyl)prop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C(=C\N=C\C)C(F)(F)F |
| InChI | InChI=1S/C6H7F3N2/c1-2-11-4-5(3-10)6(7,8)9/h2-4,10H,1H3/b5-4+,10-3+,11-2+ |
| InChIKey | MWVNCRLCEYUICE-OSYLHJNZSA-N |
| XLogP | 2.17 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|