C17H22O6 — CID 126747973
ethoxycarbonyl (E)-3-[(1E,7E)-6,7-dimethoxycyclonona-1,5,7-trien-1-yl]prop-2-enoate (PubChem CID 126747973) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is ethoxycarbonyl (E)-3-[(1E,7E)-6,7-dimethoxycyclonona-1,5,7-trien-1-yl]prop-2-enoate.
| Compound Name | ethoxycarbonyl (E)-3-[(1E,7E)-6,7-dimethoxycyclonona-1,5,7-trien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 126747973 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethoxycarbonyl (E)-3-[(1E,7E)-6,7-dimethoxycyclonona-1,5,7-trien-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)OC(=O)/C=C/C1=C/CCC=C(OC)/C(OC)=C\C1 |
| InChI | InChI=1S/C17H22O6/c1-4-22-17(19)23-16(18)12-10-13-7-5-6-8-14(20-2)15(21-3)11-9-13/h7-8,10-12H,4-6,9H2,1-3H3/b12-10+,13-7+,14-8?,15-11+ |
| InChIKey | YOAYFQZOVRLDDD-KRAKZWJASA-N |
| XLogP | 3.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|