C26H27F3N2O3 — CID 126749912
4-benzyl-3-[(E)-3-[2-(4-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 126749912) has the molecular formula C26H27F3N2O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is 4-benzyl-3-[(E)-3-[2-(4-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(E)-3-[2-(4-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126749912 |
| Molecular Formula | C26H27F3N2O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 4-benzyl-3-[(E)-3-[2-(4-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC1CCN(c2cc(C(F)(F)F)ccc2/C=C/C(=O)N2C(=O)OCC2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H27F3N2O3/c1-18-11-13-30(14-12-18)23-16-21(26(27,28)29)9-7-20(23)8-10-24(32)31-22(17-34-25(31)33)15-19-5-3-2-4-6-19/h2-10,16,18,22H,11-15,17H2,1H3/b10-8+ |
| InChIKey | JNCQZWJGBYVBBW-CSKARUKUSA-N |
| XLogP | 5.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|